About ethane;(Z,2E)-2-prop-2-enylidenehex-3-enimidamide
ethane;(Z,2E)-2-prop-2-enylidenehex-3-enimidamide (PubChem CID 142843946) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is ethane;(Z,2E)-2-prop-2-enylidenehex-3-enimidamide.
Molecular Properties
| Compound Name | ethane;(Z,2E)-2-prop-2-enylidenehex-3-enimidamide |
| PubChem CID | 142843946 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | ethane;(Z,2E)-2-prop-2-enylidenehex-3-enimidamide |
| SMILES | CC.[H]/N=C(N)/C(/C=C\CC)=C/C=C |
| InChI | InChI=1S/C9H14N2.C2H6/c1-3-5-7-8(6-4-2)9(10)11;1-2/h4-7H,2-3H2,1H3,(H3,10,11);1-2H3/b7-5-,8-6+; |
| InChIKey | WRLULXQVJIPKFA-KHCQPJBVSA-N |
| XLogP | 3.03 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z,2E)-2-prop-2-enylidenehex-3-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z,2E)-2-prop-2-enylidenehex-3-enimidamide?
The IUPAC name of ethane;(Z,2E)-2-prop-2-enylidenehex-3-enimidamide (CID 142843946) is ethane;(Z,2E)-2-prop-2-enylidenehex-3-enimidamide.
What is the SMILES notation for ethane;(Z,2E)-2-prop-2-enylidenehex-3-enimidamide?
The canonical SMILES for ethane;(Z,2E)-2-prop-2-enylidenehex-3-enimidamide is CC.[H]/N=C(N)/C(/C=C\CC)=C/C=C.
What is the InChIKey of ethane;(Z,2E)-2-prop-2-enylidenehex-3-enimidamide?
The InChIKey is WRLULXQVJIPKFA-KHCQPJBVSA-N. The full InChI is InChI=1S/C9H14N2.C2H6/c1-3-5-7-8(6-4-2)9(10)11;1-2/h4-7H,2-3H2,1H3,(H3,10,11);1-2H3/b7-5-,8-6+;.
What are the key properties of ethane;(Z,2E)-2-prop-2-enylidenehex-3-enimidamide?
ethane;(Z,2E)-2-prop-2-enylidenehex-3-enimidamide has a molecular weight of 180.29 g/mol, XLogP of 3.03, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z,2E)-2-prop-2-enylidenehex-3-enimidamide is sourced from PubChem (CID 142843946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).