About ethyl (E)-pent-2-enimidate
ethyl (E)-pent-2-enimidate (PubChem CID 55267720) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is ethyl (E)-pent-2-enimidate.
Molecular Properties
| Compound Name | ethyl (E)-pent-2-enimidate |
| PubChem CID | 55267720 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | ethyl (E)-pent-2-enimidate |
| SMILES | [H]/N=C(/C=C/CC)OCC |
| InChI | InChI=1S/C7H13NO/c1-3-5-6-7(8)9-4-2/h5-6,8H,3-4H2,1-2H3/b6-5+,8-7- |
| InChIKey | BMEIKTYXHCTZGH-MDAAKZFYSA-N |
| XLogP | 1.97 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-pent-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-pent-2-enimidate?
The IUPAC name of ethyl (E)-pent-2-enimidate (CID 55267720) is ethyl (E)-pent-2-enimidate.
What is the SMILES notation for ethyl (E)-pent-2-enimidate?
The canonical SMILES for ethyl (E)-pent-2-enimidate is [H]/N=C(/C=C/CC)OCC.
What is the InChIKey of ethyl (E)-pent-2-enimidate?
The InChIKey is BMEIKTYXHCTZGH-MDAAKZFYSA-N. The full InChI is InChI=1S/C7H13NO/c1-3-5-6-7(8)9-4-2/h5-6,8H,3-4H2,1-2H3/b6-5+,8-7-.
What are the key properties of ethyl (E)-pent-2-enimidate?
ethyl (E)-pent-2-enimidate has a molecular weight of 127.19 g/mol, XLogP of 1.97, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-pent-2-enimidate is sourced from PubChem (CID 55267720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).