C13H24O2 — CID 165130327
ethane;(3Z,5E)-3-ethoxy-4-methoxyocta-1,3,5-triene (PubChem CID 165130327) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is ethane;(3Z,5E)-3-ethoxy-4-methoxyocta-1,3,5-triene.
| Compound Name | ethane;(3Z,5E)-3-ethoxy-4-methoxyocta-1,3,5-triene |
|---|---|
| PubChem CID | 165130327 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | ethane;(3Z,5E)-3-ethoxy-4-methoxyocta-1,3,5-triene |
| SMILES | C=C/C(OCC)=C(\C=C\CC)OC.CC |
| InChI | InChI=1S/C11H18O2.C2H6/c1-5-8-9-11(12-4)10(6-2)13-7-3;1-2/h6,8-9H,2,5,7H2,1,3-4H3;1-2H3/b9-8+,11-10-; |
| InChIKey | DZEDSSVGXCULHF-AZYXJCANSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|