C7H10N2O — CID 142200676
(2E)-2-ethenyl-4-hydroxypenta-2,4-dienimidamide (PubChem CID 142200676) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is (2E)-2-ethenyl-4-hydroxypenta-2,4-dienimidamide.
| Compound Name | (2E)-2-ethenyl-4-hydroxypenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 142200676 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | (2E)-2-ethenyl-4-hydroxypenta-2,4-dienimidamide |
| SMILES | [H]/N=C(N)/C(C=C)=C/C(=C)O |
| InChI | InChI=1S/C7H10N2O/c1-3-6(7(8)9)4-5(2)10/h3-4,10H,1-2H2,(H3,8,9)/b6-4+ |
| InChIKey | IEKXHEQTHINTGJ-GQCTYLIASA-N |
| XLogP | 1.11 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|