C7H8ClFN2 — CID 143207214
(2Z)-4-chloro-2-(1-fluoroethenyl)penta-2,4-dienimidamide (PubChem CID 143207214) has the molecular formula C7H8ClFN2 and a molecular weight of 174.61 g/mol. Its IUPAC name is (2Z)-4-chloro-2-(1-fluoroethenyl)penta-2,4-dienimidamide.
| Compound Name | (2Z)-4-chloro-2-(1-fluoroethenyl)penta-2,4-dienimidamide |
|---|---|
| PubChem CID | 143207214 |
| Molecular Formula | C7H8ClFN2 |
| Molecular Weight | 174.61 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | (2Z)-4-chloro-2-(1-fluoroethenyl)penta-2,4-dienimidamide |
| SMILES | [H]/N=C(N)/C(=C/C(=C)Cl)C(=C)F |
| InChI | InChI=1S/C7H8ClFN2/c1-4(8)3-6(5(2)9)7(10)11/h3H,1-2H2,(H3,10,11)/b6-3+ |
| InChIKey | YRUVUUHCLNWCOD-ZZXKWVIFSA-N |
| XLogP | 2.08 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.61 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|