C6H7F2N — CID 143077726
(3E)-2,5-difluorohexa-1,3,5-trien-3-amine (PubChem CID 143077726) has the molecular formula C6H7F2N and a molecular weight of 131.12 g/mol. Its IUPAC name is (3E)-2,5-difluorohexa-1,3,5-trien-3-amine.
| Compound Name | (3E)-2,5-difluorohexa-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 143077726 |
| Molecular Formula | C6H7F2N |
| Molecular Weight | 131.12 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | (3E)-2,5-difluorohexa-1,3,5-trien-3-amine |
| SMILES | C=C(F)/C=C(/N)C(=C)F |
| InChI | InChI=1S/C6H7F2N/c1-4(7)3-6(9)5(2)8/h3H,1-2,9H2/b6-3+ |
| InChIKey | ZBPZNRIHGFCEIX-ZZXKWVIFSA-N |
| XLogP | 1.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.12 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|