C2H5F2NO — CID 171932245
1,1-difluoroethene;hydroxylamine (PubChem CID 171932245) has the molecular formula C2H5F2NO and a molecular weight of 97.06 g/mol. Its IUPAC name is 1,1-difluoroethene;hydroxylamine.
| Compound Name | 1,1-difluoroethene;hydroxylamine |
|---|---|
| PubChem CID | 171932245 |
| Molecular Formula | C2H5F2NO |
| Molecular Weight | 97.06 g/mol |
| Exact Mass | 97.03 |
| IUPAC Name | 1,1-difluoroethene;hydroxylamine |
| SMILES | C=C(F)F.NO |
| InChI | InChI=1S/C2H2F2.H3NO/c1-2(3)4;1-2/h1H2;2H,1H2 |
| InChIKey | FGBDYGQVSVMWFZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 97.06 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|