About chloroform;1,1-difluoroethene
chloroform;1,1-difluoroethene (PubChem CID 175134807) has the molecular formula C3H3Cl3F2
and a molecular weight of 183.41 g/mol. Its IUPAC name is chloroform;1,1-difluoroethene.
Molecular Properties
| Compound Name | chloroform;1,1-difluoroethene |
| PubChem CID | 175134807 |
| Molecular Formula | C3H3Cl3F2 |
| Molecular Weight | 183.41 g/mol |
| Exact Mass | 181.93 |
| IUPAC Name | chloroform;1,1-difluoroethene |
| SMILES | C=C(F)F.ClC(Cl)Cl |
| InChI | InChI=1S/C2H2F2.CHCl3/c1-2(3)4;2-1(3)4/h1H2;1H |
| InChIKey | YYWZCSWCUPTUTH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroform;1,1-difluoroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;1,1-difluoroethene?
The IUPAC name of chloroform;1,1-difluoroethene (CID 175134807) is chloroform;1,1-difluoroethene.
What is the SMILES notation for chloroform;1,1-difluoroethene?
The canonical SMILES for chloroform;1,1-difluoroethene is C=C(F)F.ClC(Cl)Cl.
What is the InChIKey of chloroform;1,1-difluoroethene?
The InChIKey is YYWZCSWCUPTUTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2F2.CHCl3/c1-2(3)4;2-1(3)4/h1H2;1H.
What are the key properties of chloroform;1,1-difluoroethene?
chloroform;1,1-difluoroethene has a molecular weight of 183.41 g/mol, XLogP of 3.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;1,1-difluoroethene is sourced from PubChem (CID 175134807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).