C2H3F2I — CID 158690822
1,1-difluoroethene;hydroiodide (PubChem CID 158690822) has the molecular formula C2H3F2I and a molecular weight of 191.95 g/mol. Its IUPAC name is 1,1-difluoroethene;hydroiodide.
| Compound Name | 1,1-difluoroethene;hydroiodide |
|---|---|
| PubChem CID | 158690822 |
| Molecular Formula | C2H3F2I |
| Molecular Weight | 191.95 g/mol |
| Exact Mass | 191.92 |
| IUPAC Name | 1,1-difluoroethene;hydroiodide |
| SMILES | C=C(F)F.I |
| InChI | InChI=1S/C2H2F2.HI/c1-2(3)4;/h1H2;1H |
| InChIKey | GHFNPQGPYQSVEW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.95 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|