About (3E)-2,4-difluorohexa-1,3,5-triene;zinc
(3E)-2,4-difluorohexa-1,3,5-triene;zinc (PubChem CID 166121313) has the molecular formula C6H5F2Zn-
and a molecular weight of 180.49 g/mol. Its IUPAC name is (3E)-2,4-difluorohexa-1,3,5-triene;zinc.
Molecular Properties
| Compound Name | (3E)-2,4-difluorohexa-1,3,5-triene;zinc |
| PubChem CID | 166121313 |
| Molecular Formula | C6H5F2Zn- |
| Molecular Weight | 180.49 g/mol |
| Exact Mass | 178.97 |
| IUPAC Name | (3E)-2,4-difluorohexa-1,3,5-triene;zinc |
| SMILES | C=[C-]/C(F)=C\C(=C)F.[Zn] |
| InChI | InChI=1S/C6H5F2.Zn/c1-3-6(8)4-5(2)7;/h4H,1-2H2;/q-1;/b6-4+; |
| InChIKey | IGEVYFSPLRMDER-CVDVRWGVSA-N |
| XLogP | 2.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-2,4-difluorohexa-1,3,5-triene;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-2,4-difluorohexa-1,3,5-triene;zinc?
The IUPAC name of (3E)-2,4-difluorohexa-1,3,5-triene;zinc (CID 166121313) is (3E)-2,4-difluorohexa-1,3,5-triene;zinc.
What is the SMILES notation for (3E)-2,4-difluorohexa-1,3,5-triene;zinc?
The canonical SMILES for (3E)-2,4-difluorohexa-1,3,5-triene;zinc is C=[C-]/C(F)=C\C(=C)F.[Zn].
What is the InChIKey of (3E)-2,4-difluorohexa-1,3,5-triene;zinc?
The InChIKey is IGEVYFSPLRMDER-CVDVRWGVSA-N. The full InChI is InChI=1S/C6H5F2.Zn/c1-3-6(8)4-5(2)7;/h4H,1-2H2;/q-1;/b6-4+;.
What are the key properties of (3E)-2,4-difluorohexa-1,3,5-triene;zinc?
(3E)-2,4-difluorohexa-1,3,5-triene;zinc has a molecular weight of 180.49 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-2,4-difluorohexa-1,3,5-triene;zinc is sourced from PubChem (CID 166121313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).