C8H11F — CID 142052803
(3Z)-4-ethyl-2-fluorohexa-1,3,5-triene (PubChem CID 142052803) has the molecular formula C8H11F and a molecular weight of 126.17 g/mol. Its IUPAC name is (3Z)-4-ethyl-2-fluorohexa-1,3,5-triene.
| Compound Name | (3Z)-4-ethyl-2-fluorohexa-1,3,5-triene |
|---|---|
| PubChem CID | 142052803 |
| Molecular Formula | C8H11F |
| Molecular Weight | 126.17 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | (3Z)-4-ethyl-2-fluorohexa-1,3,5-triene |
| SMILES | C=C/C(=C\C(=C)F)CC |
| InChI | InChI=1S/C8H11F/c1-4-8(5-2)6-7(3)9/h4,6H,1,3,5H2,2H3/b8-6+ |
| InChIKey | VTFQDYMVMWMFNP-SOFGYWHQSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|