C6H12N2 — CID 88987494
[(1Z)-2-ethylbuta-1,3-dienyl]hydrazine (PubChem CID 88987494) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is [(1Z)-2-ethylbuta-1,3-dienyl]hydrazine.
| Compound Name | [(1Z)-2-ethylbuta-1,3-dienyl]hydrazine |
|---|---|
| PubChem CID | 88987494 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | [(1Z)-2-ethylbuta-1,3-dienyl]hydrazine |
| SMILES | C=C/C(=C\NN)CC |
| InChI | InChI=1S/C6H12N2/c1-3-6(4-2)5-8-7/h3,5,8H,1,4,7H2,2H3/b6-5+ |
| InChIKey | HOHIAAUJSBAZSK-AATRIKPKSA-N |
| XLogP | 0.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|