C7H10FNO — CID 170178694
(2E)-2-ethyl-4-fluoropenta-2,4-dienamide (PubChem CID 170178694) has the molecular formula C7H10FNO and a molecular weight of 143.16 g/mol. Its IUPAC name is (2E)-2-ethyl-4-fluoropenta-2,4-dienamide.
| Compound Name | (2E)-2-ethyl-4-fluoropenta-2,4-dienamide |
|---|---|
| PubChem CID | 170178694 |
| Molecular Formula | C7H10FNO |
| Molecular Weight | 143.16 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | (2E)-2-ethyl-4-fluoropenta-2,4-dienamide |
| SMILES | C=C(F)/C=C(\CC)C(N)=O |
| InChI | InChI=1S/C7H10FNO/c1-3-6(7(9)10)4-5(2)8/h4H,2-3H2,1H3,(H2,9,10)/b6-4+ |
| InChIKey | WGSDDZMLKRTXGT-GQCTYLIASA-N |
| XLogP | 1.29 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|