C7H8BrFO — CID 178133361
(2E,4E)-4-bromo-6-fluorohepta-2,4,6-trien-3-ol (PubChem CID 178133361) has the molecular formula C7H8BrFO and a molecular weight of 207.04 g/mol. Its IUPAC name is (2E,4E)-4-bromo-6-fluorohepta-2,4,6-trien-3-ol.
| Compound Name | (2E,4E)-4-bromo-6-fluorohepta-2,4,6-trien-3-ol |
|---|---|
| PubChem CID | 178133361 |
| Molecular Formula | C7H8BrFO |
| Molecular Weight | 207.04 g/mol |
| Exact Mass | 205.97 |
| IUPAC Name | (2E,4E)-4-bromo-6-fluorohepta-2,4,6-trien-3-ol |
| SMILES | C=C(F)/C=C(Br)\C(O)=C/C |
| InChI | InChI=1S/C7H8BrFO/c1-3-7(10)6(8)4-5(2)9/h3-4,10H,2H2,1H3/b6-4+,7-3+ |
| InChIKey | ONKWZBOMXBGTPD-DVFLZCIWSA-N |
| XLogP | 3.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.04 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|