C10H14FN — CID 144654304
(2Z,4E,5Z)-4-ethylidene-7-fluoroocta-2,5,7-trien-3-amine (PubChem CID 144654304) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is (2Z,4E,5Z)-4-ethylidene-7-fluoroocta-2,5,7-trien-3-amine.
| Compound Name | (2Z,4E,5Z)-4-ethylidene-7-fluoroocta-2,5,7-trien-3-amine |
|---|---|
| PubChem CID | 144654304 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (2Z,4E,5Z)-4-ethylidene-7-fluoroocta-2,5,7-trien-3-amine |
| SMILES | C=C(F)/C=C\C(=C/C)\C(N)=C\C |
| InChI | InChI=1S/C10H14FN/c1-4-9(10(12)5-2)7-6-8(3)11/h4-7H,3,12H2,1-2H3/b7-6-,9-4+,10-5- |
| InChIKey | OMVDNPOYSVONTO-JEMDVOEQSA-N |
| XLogP | 2.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|