C7H8FNO — CID 123549824
2-fluoro-5-nitrosohepta-1,3,5-triene (PubChem CID 123549824) has the molecular formula C7H8FNO and a molecular weight of 141.14 g/mol. Its IUPAC name is 2-fluoro-5-nitrosohepta-1,3,5-triene.
| Compound Name | 2-fluoro-5-nitrosohepta-1,3,5-triene |
|---|---|
| PubChem CID | 123549824 |
| Molecular Formula | C7H8FNO |
| Molecular Weight | 141.14 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 2-fluoro-5-nitrosohepta-1,3,5-triene |
| SMILES | C=C(F)C=CC(=CC)N=O |
| InChI | InChI=1S/C7H8FNO/c1-3-7(9-10)5-4-6(2)8/h3-5H,2H2,1H3 |
| InChIKey | VAYDWECWIVIZRT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.14 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|