C15H21NO — CID 142842980
[(5Z,6Z,8E)-5-ethylidene-8-nitrosodeca-1,6,8-trien-3-yl]cyclopropane (PubChem CID 142842980) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is [(5Z,6Z,8E)-5-ethylidene-8-nitrosodeca-1,6,8-trien-3-yl]cyclopropane.
| Compound Name | [(5Z,6Z,8E)-5-ethylidene-8-nitrosodeca-1,6,8-trien-3-yl]cyclopropane |
|---|---|
| PubChem CID | 142842980 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | [(5Z,6Z,8E)-5-ethylidene-8-nitrosodeca-1,6,8-trien-3-yl]cyclopropane |
| SMILES | C=CC(CC(/C=C\C(=C/C)N=O)=C/C)C1CC1 |
| InChI | InChI=1S/C15H21NO/c1-4-12(7-10-15(6-3)16-17)11-13(5-2)14-8-9-14/h4-7,10,13-14H,2,8-9,11H2,1,3H3/b10-7-,12-4+,15-6+ |
| InChIKey | UFDHOHAEVCPWBK-PWNLLOFVSA-N |
| XLogP | 4.76 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|