About 2-cyclopropylbutanedial
2-cyclopropylbutanedial (PubChem CID 141171977) has the molecular formula C7H10O2
and a molecular weight of 126.15 g/mol. Its IUPAC name is 2-cyclopropylbutanedial.
Molecular Properties
| Compound Name | 2-cyclopropylbutanedial |
| PubChem CID | 141171977 |
| Molecular Formula | C7H10O2 |
| Molecular Weight | 126.15 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | 2-cyclopropylbutanedial |
| SMILES | O=CCC(C=O)C1CC1 |
| InChI | InChI=1S/C7H10O2/c8-4-3-7(5-9)6-1-2-6/h4-7H,1-3H2 |
| InChIKey | GFDWDIMRDBDEEH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.15 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropylbutanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylbutanedial?
The IUPAC name of 2-cyclopropylbutanedial (CID 141171977) is 2-cyclopropylbutanedial.
What is the SMILES notation for 2-cyclopropylbutanedial?
The canonical SMILES for 2-cyclopropylbutanedial is O=CCC(C=O)C1CC1.
What is the InChIKey of 2-cyclopropylbutanedial?
The InChIKey is GFDWDIMRDBDEEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c8-4-3-7(5-9)6-1-2-6/h4-7H,1-3H2.
What are the key properties of 2-cyclopropylbutanedial?
2-cyclopropylbutanedial has a molecular weight of 126.15 g/mol, XLogP of 0.80, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylbutanedial is sourced from PubChem (CID 141171977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).