C19H37NO — CID 144881902
N-[(1Z,3E)-3-[(4,4-dimethylcyclohexyl)oxymethyl]penta-1,3-dienyl]methanimine;ethane (PubChem CID 144881902) has the molecular formula C19H37NO and a molecular weight of 295.51 g/mol. Its IUPAC name is N-[(1Z,3E)-3-[(4,4-dimethylcyclohexyl)oxymethyl]penta-1,3-dienyl]methanimine;ethane.
| Compound Name | N-[(1Z,3E)-3-[(4,4-dimethylcyclohexyl)oxymethyl]penta-1,3-dienyl]methanimine;ethane |
|---|---|
| PubChem CID | 144881902 |
| Molecular Formula | C19H37NO |
| Molecular Weight | 295.51 g/mol |
| Exact Mass | 295.29 |
| IUPAC Name | N-[(1Z,3E)-3-[(4,4-dimethylcyclohexyl)oxymethyl]penta-1,3-dienyl]methanimine;ethane |
| SMILES | C=N/C=C\C(=C/C)COC1CCC(C)(C)CC1.CC.CC |
| InChI | InChI=1S/C15H25NO.2C2H6/c1-5-13(8-11-16-4)12-17-14-6-9-15(2,3)10-7-14;2*1-2/h5,8,11,14H,4,6-7,9-10,12H2,1-3H3;2*1-2H3/b11-8-,13-5+;; |
| InChIKey | PQKBVZNWEGSVOR-DGYGJLBNSA-N |
| XLogP | 6.18 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|