C14H27ClO — CID 114340907
4-(6-chlorohexoxy)-1,1-dimethylcyclohexane (PubChem CID 114340907) has the molecular formula C14H27ClO and a molecular weight of 246.82 g/mol. Its IUPAC name is 4-(6-chlorohexoxy)-1,1-dimethylcyclohexane.
| Compound Name | 4-(6-chlorohexoxy)-1,1-dimethylcyclohexane |
|---|---|
| PubChem CID | 114340907 |
| Molecular Formula | C14H27ClO |
| Molecular Weight | 246.82 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 4-(6-chlorohexoxy)-1,1-dimethylcyclohexane |
| SMILES | CC1(C)CCC(OCCCCCCCl)CC1 |
| InChI | InChI=1S/C14H27ClO/c1-14(2)9-7-13(8-10-14)16-12-6-4-3-5-11-15/h13H,3-12H2,1-2H3 |
| InChIKey | AVAXUVHEOVNUTH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.82 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|