C28H48Cl2O3 — CID 18633597
14,14-dichloro-3,11-diheptoxydispiro[5.1.58.16]tetradecan-7-one (PubChem CID 18633597) has the molecular formula C28H48Cl2O3 and a molecular weight of 503.60 g/mol. Its IUPAC name is 14,14-dichloro-3,11-diheptoxydispiro[5.1.58.16]tetradecan-7-one.
| Compound Name | 14,14-dichloro-3,11-diheptoxydispiro[5.1.58.16]tetradecan-7-one |
|---|---|
| PubChem CID | 18633597 |
| Molecular Formula | C28H48Cl2O3 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | 14,14-dichloro-3,11-diheptoxydispiro[5.1.58.16]tetradecan-7-one |
| SMILES | CCCCCCCOC1CCC2(CC1)C(=O)C1(CCC(OCCCCCCC)CC1)C2(Cl)Cl |
| InChI | InChI=1S/C28H48Cl2O3/c1-3-5-7-9-11-21-32-23-13-17-26(18-14-23)25(31)27(28(26,29)30)19-15-24(16-20-27)33-22-12-10-8-6-4-2/h23-24H,3-22H2,1-2H3 |
| InChIKey | BWMLSIMWLCSKBS-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|