C36H61FO3 — CID 18633553
7-fluoro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecan-14-one (PubChem CID 18633553) has the molecular formula C36H61FO3 and a molecular weight of 560.88 g/mol. Its IUPAC name is 7-fluoro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecan-14-one.
| Compound Name | 7-fluoro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecan-14-one |
|---|---|
| PubChem CID | 18633553 |
| Molecular Formula | C36H61FO3 |
| Molecular Weight | 560.88 g/mol |
| Exact Mass | 560.46 |
| IUPAC Name | 7-fluoro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecan-14-one |
| SMILES | CCCCCOC1CCC(C2CCC3(CC2)C(=O)C2(CCC(C4CCC(OCCCCC)CC4)CC2)C3F)CC1 |
| InChI | InChI=1S/C36H61FO3/c1-3-5-7-25-39-31-13-9-27(10-14-31)29-17-21-35(22-18-29)33(37)36(34(35)38)23-19-30(20-24-36)28-11-15-32(16-12-28)40-26-8-6-4-2/h27-33H,3-26H2,1-2H3 |
| InChIKey | MENUNJJODYGARA-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.88 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|