C26H45FO3 — CID 18633609
7-fluoro-3,11-dihexoxydispiro[5.1.58.16]tetradecan-14-one (PubChem CID 18633609) has the molecular formula C26H45FO3 and a molecular weight of 424.64 g/mol. Its IUPAC name is 7-fluoro-3,11-dihexoxydispiro[5.1.58.16]tetradecan-14-one.
| Compound Name | 7-fluoro-3,11-dihexoxydispiro[5.1.58.16]tetradecan-14-one |
|---|---|
| PubChem CID | 18633609 |
| Molecular Formula | C26H45FO3 |
| Molecular Weight | 424.64 g/mol |
| Exact Mass | 424.34 |
| IUPAC Name | 7-fluoro-3,11-dihexoxydispiro[5.1.58.16]tetradecan-14-one |
| SMILES | CCCCCCOC1CCC2(CC1)C(=O)C1(CCC(OCCCCCC)CC1)C2F |
| InChI | InChI=1S/C26H45FO3/c1-3-5-7-9-19-29-21-11-15-25(16-12-21)23(27)26(24(25)28)17-13-22(14-18-26)30-20-10-8-6-4-2/h21-23H,3-20H2,1-2H3 |
| InChIKey | QHWFPEIAOYXTKA-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.64 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|