C9H15NO — CID 142835629
acetaldehyde;N-[(2Z,4E)-hexa-2,4-dien-3-yl]methanimine (PubChem CID 142835629) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is acetaldehyde;N-[(2Z,4E)-hexa-2,4-dien-3-yl]methanimine.
| Compound Name | acetaldehyde;N-[(2Z,4E)-hexa-2,4-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 142835629 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | acetaldehyde;N-[(2Z,4E)-hexa-2,4-dien-3-yl]methanimine |
| SMILES | C=NC(=C\C)/C=C/C.CC=O |
| InChI | InChI=1S/C7H11N.C2H4O/c1-4-6-7(5-2)8-3;1-2-3/h4-6H,3H2,1-2H3;2H,1H3/b6-4+,7-5-; |
| InChIKey | QXMQRZFXTUJAIV-XGGDKXJTSA-N |
| XLogP | 2.37 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|