C10H18FN — CID 144685433
ethane;(4Z)-6-fluoro-3-methylidenehepta-4,6-dien-1-amine (PubChem CID 144685433) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is ethane;(4Z)-6-fluoro-3-methylidenehepta-4,6-dien-1-amine.
| Compound Name | ethane;(4Z)-6-fluoro-3-methylidenehepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 144685433 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | ethane;(4Z)-6-fluoro-3-methylidenehepta-4,6-dien-1-amine |
| SMILES | C=C(F)/C=C\C(=C)CCN.CC |
| InChI | InChI=1S/C8H12FN.C2H6/c1-7(5-6-10)3-4-8(2)9;1-2/h3-4H,1-2,5-6,10H2;1-2H3/b4-3-; |
| InChIKey | XXFCWRIRJRMDNY-LNKPDPKZSA-N |
| XLogP | 2.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|