C11H15FO2 — CID 166152910
ethyl (5Z)-7-fluoro-4-methylideneocta-5,7-dienoate (PubChem CID 166152910) has the molecular formula C11H15FO2 and a molecular weight of 198.24 g/mol. Its IUPAC name is ethyl (5Z)-7-fluoro-4-methylideneocta-5,7-dienoate.
| Compound Name | ethyl (5Z)-7-fluoro-4-methylideneocta-5,7-dienoate |
|---|---|
| PubChem CID | 166152910 |
| Molecular Formula | C11H15FO2 |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | ethyl (5Z)-7-fluoro-4-methylideneocta-5,7-dienoate |
| SMILES | C=C(F)/C=C\C(=C)CCC(=O)OCC |
| InChI | InChI=1S/C11H15FO2/c1-4-14-11(13)8-6-9(2)5-7-10(3)12/h5,7H,2-4,6,8H2,1H3/b7-5- |
| InChIKey | LGLVYXMMWVRTHY-ALCCZGGFSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|