C7H11N — CID 176543493
4-methylhexa-2,4,5-trien-3-amine (PubChem CID 176543493) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is 4-methylhexa-2,4,5-trien-3-amine.
| Compound Name | 4-methylhexa-2,4,5-trien-3-amine |
|---|---|
| PubChem CID | 176543493 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 4-methylhexa-2,4,5-trien-3-amine |
| SMILES | C=C=C(C)C(N)=CC |
| InChI | InChI=1S/C7H11N/c1-4-6(3)7(8)5-2/h5H,1,8H2,2-3H3 |
| InChIKey | WJVVSZSGAVKGRG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|