C7H10 — CID 90999929
(4E)-4-methylhexa-1,2,4-triene (PubChem CID 90999929) has the molecular formula C7H10 and a molecular weight of 94.16 g/mol. Its IUPAC name is (4E)-4-methylhexa-1,2,4-triene.
| Compound Name | (4E)-4-methylhexa-1,2,4-triene |
|---|---|
| PubChem CID | 90999929 |
| Molecular Formula | C7H10 |
| Molecular Weight | 94.16 g/mol |
| Exact Mass | 94.08 |
| IUPAC Name | (4E)-4-methylhexa-1,2,4-triene |
| SMILES | C=C=C/C(C)=C/C |
| InChI | InChI=1S/C7H10/c1-4-6-7(3)5-2/h5-6H,1H2,2-3H3/b7-5+ |
| InChIKey | GJKYDBAQKKMTQV-FNORWQNLSA-N |
| XLogP | 2.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 94.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|