C10H17NO8P2S — CID 123584997
[[[(4Z)-5-methylocta-2,4,6,7-tetraen-2-yl]sulfonylamino]-phosphonomethyl]phosphonic acid (PubChem CID 123584997) has the molecular formula C10H17NO8P2S and a molecular weight of 373.26 g/mol. Its IUPAC name is [[[(4Z)-5-methylocta-2,4,6,7-tetraen-2-yl]sulfonylamino]-phosphonomethyl]phosphonic acid.
| Compound Name | [[[(4Z)-5-methylocta-2,4,6,7-tetraen-2-yl]sulfonylamino]-phosphonomethyl]phosphonic acid |
|---|---|
| PubChem CID | 123584997 |
| Molecular Formula | C10H17NO8P2S |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | [[[(4Z)-5-methylocta-2,4,6,7-tetraen-2-yl]sulfonylamino]-phosphonomethyl]phosphonic acid |
| SMILES | C=C=C/C(C)=C\C=C(C)S(=O)(=O)NC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C10H17NO8P2S/c1-4-5-8(2)6-7-9(3)22(18,19)11-10(20(12,13)14)21(15,16)17/h5-7,10-11H,1H2,2-3H3,(H2,12,13,14)(H2,15,16,17)/b8-6-,9-7? |
| InChIKey | GVSMWJKHONZACL-VFUVOHNVSA-N |
| XLogP | 0.74 |
| TPSA | 161.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|