C7H14NO4P — CID 22111436
[2-methyl-1-(prop-2-enoylamino)propyl]phosphonic acid (PubChem CID 22111436) has the molecular formula C7H14NO4P and a molecular weight of 207.17 g/mol. Its IUPAC name is [2-methyl-1-(prop-2-enoylamino)propyl]phosphonic acid.
| Compound Name | [2-methyl-1-(prop-2-enoylamino)propyl]phosphonic acid |
|---|---|
| PubChem CID | 22111436 |
| Molecular Formula | C7H14NO4P |
| Molecular Weight | 207.17 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | [2-methyl-1-(prop-2-enoylamino)propyl]phosphonic acid |
| SMILES | C=CC(=O)NC(C(C)C)P(=O)(O)O |
| InChI | InChI=1S/C7H14NO4P/c1-4-6(9)8-7(5(2)3)13(10,11)12/h4-5,7H,1H2,2-3H3,(H,8,9)(H2,10,11,12) |
| InChIKey | ZSLGZVNTZYLIAJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|