C9H19ClN2O2 — CID 19836215
[2-hydroxy-1-(prop-2-enoylamino)propyl]-trimethylazanium chloride (PubChem CID 19836215) has the molecular formula C9H19ClN2O2 and a molecular weight of 222.72 g/mol. Its IUPAC name is [2-hydroxy-1-(prop-2-enoylamino)propyl]-trimethylazanium chloride.
| Compound Name | [2-hydroxy-1-(prop-2-enoylamino)propyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 19836215 |
| Molecular Formula | C9H19ClN2O2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | [2-hydroxy-1-(prop-2-enoylamino)propyl]-trimethylazanium chloride |
| SMILES | C=CC(=O)NC(C(C)O)[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C9H18N2O2.ClH/c1-6-8(13)10-9(7(2)12)11(3,4)5;/h6-7,9,12H,1H2,2-5H3;1H |
| InChIKey | LTHGKRICMVVPBI-UHFFFAOYSA-N |
| XLogP | -3.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|