C7H13NO3P+ — CID 156505572
hydroxy-[2-methyl-1-(prop-2-enoylamino)propyl]-oxophosphanium (PubChem CID 156505572) has the molecular formula C7H13NO3P+ and a molecular weight of 190.16 g/mol. Its IUPAC name is hydroxy-[2-methyl-1-(prop-2-enoylamino)propyl]-oxophosphanium.
| Compound Name | hydroxy-[2-methyl-1-(prop-2-enoylamino)propyl]-oxophosphanium |
|---|---|
| PubChem CID | 156505572 |
| Molecular Formula | C7H13NO3P+ |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | hydroxy-[2-methyl-1-(prop-2-enoylamino)propyl]-oxophosphanium |
| SMILES | C=CC(=O)NC(C(C)C)[P+](=O)O |
| InChI | InChI=1S/C7H12NO3P/c1-4-6(9)8-7(5(2)3)12(10)11/h4-5,7H,1H2,2-3H3,(H-,8,9,10,11)/p+1 |
| InChIKey | UWKDYRJOLVVVES-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|