C7H15NO5S — CID 141274766
2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid;hydrate (PubChem CID 141274766) has the molecular formula C7H15NO5S and a molecular weight of 225.27 g/mol. Its IUPAC name is 2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid;hydrate.
| Compound Name | 2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid;hydrate |
|---|---|
| PubChem CID | 141274766 |
| Molecular Formula | C7H15NO5S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid;hydrate |
| SMILES | C=CC(=O)NC(C(C)C)S(=O)(=O)O.O |
| InChI | InChI=1S/C7H13NO4S.H2O/c1-4-6(9)8-7(5(2)3)13(10,11)12;/h4-5,7H,1H2,2-3H3,(H,8,9)(H,10,11,12);1H2 |
| InChIKey | ZJDZFHFNXYPQEF-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 114.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|