C12H21NO7S — CID 87477027
2-hydroxyethyl prop-2-enoate;2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid (PubChem CID 87477027) has the molecular formula C12H21NO7S and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-hydroxyethyl prop-2-enoate;2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid.
| Compound Name | 2-hydroxyethyl prop-2-enoate;2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 87477027 |
| Molecular Formula | C12H21NO7S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-hydroxyethyl prop-2-enoate;2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid |
| SMILES | C=CC(=O)NC(C(C)C)S(=O)(=O)O.C=CC(=O)OCCO |
| InChI | InChI=1S/C7H13NO4S.C5H8O3/c1-4-6(9)8-7(5(2)3)13(10,11)12;1-2-5(7)8-4-3-6/h4-5,7H,1H2,2-3H3,(H,8,9)(H,10,11,12);2,6H,1,3-4H2 |
| InChIKey | MWQOIVYRHULJGP-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|