C7H16N2O4S — CID 173264796
azane;2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid (PubChem CID 173264796) has the molecular formula C7H16N2O4S and a molecular weight of 224.28 g/mol. Its IUPAC name is azane;2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid.
| Compound Name | azane;2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 173264796 |
| Molecular Formula | C7H16N2O4S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | azane;2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid |
| SMILES | C=CC(=O)NC(C(C)C)S(=O)(=O)O.N |
| InChI | InChI=1S/C7H13NO4S.H3N/c1-4-6(9)8-7(5(2)3)13(10,11)12;/h4-5,7H,1H2,2-3H3,(H,8,9)(H,10,11,12);1H3 |
| InChIKey | FBRTVPLFIRHIOX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|