C17H35N3O8S2 — CID 87563300
deuterio-(1-deuterioethyl)-diethylazanium;2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid;(prop-2-enoylamino)methanesulfonate (PubChem CID 87563300) has the molecular formula C17H35N3O8S2 and a molecular weight of 475.63 g/mol. Its IUPAC name is deuterio-(1-deuterioethyl)-diethylazanium;2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid;(prop-2-enoylamino)methanesulfonate.
| Compound Name | deuterio-(1-deuterioethyl)-diethylazanium;2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid;(prop-2-enoylamino)methanesulfonate |
|---|---|
| PubChem CID | 87563300 |
| Molecular Formula | C17H35N3O8S2 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | deuterio-(1-deuterioethyl)-diethylazanium;2-methyl-1-(prop-2-enoylamino)propane-1-sulfonic acid;(prop-2-enoylamino)methanesulfonate |
| SMILES | C=CC(=O)NC(C(C)C)S(=O)(=O)O.C=CC(=O)NCS(=O)(=O)[O-].[2H]C(C)[N+]([2H])(CC)CC |
| InChI | InChI=1S/C7H13NO4S.C6H15N.C4H7NO4S/c1-4-6(9)8-7(5(2)3)13(10,11)12;1-4-7(5-2)6-3;1-2-4(6)5-3-10(7,8)9/h4-5,7H,1H2,2-3H3,(H,8,9)(H,10,11,12);4-6H2,1-3H3;2H,1,3H2,(H,5,6)(H,7,8,9)/i;4D;/hD |
| InChIKey | HALVNQYBEPDWPF-RPTOZOJESA-N |
| XLogP | -1.12 |
| TPSA | 174.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|