C8H18N2O4S — CID 174724043
azane;2,2-dimethyl-1-(prop-2-enoylamino)propane-1-sulfonic acid (PubChem CID 174724043) has the molecular formula C8H18N2O4S and a molecular weight of 238.31 g/mol. Its IUPAC name is azane;2,2-dimethyl-1-(prop-2-enoylamino)propane-1-sulfonic acid.
| Compound Name | azane;2,2-dimethyl-1-(prop-2-enoylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 174724043 |
| Molecular Formula | C8H18N2O4S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | azane;2,2-dimethyl-1-(prop-2-enoylamino)propane-1-sulfonic acid |
| SMILES | C=CC(=O)NC(C(C)(C)C)S(=O)(=O)O.N |
| InChI | InChI=1S/C8H15NO4S.H3N/c1-5-6(10)9-7(8(2,3)4)14(11,12)13;/h5,7H,1H2,2-4H3,(H,9,10)(H,11,12,13);1H3 |
| InChIKey | CCRQLUBSPYIPPH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|