About azane;N-(3-chloro-3-methylbutan-2-yl)prop-2-enamide
azane;N-(3-chloro-3-methylbutan-2-yl)prop-2-enamide (PubChem CID 87146686) has the molecular formula C8H17ClN2O
and a molecular weight of 192.69 g/mol. Its IUPAC name is azane;N-(3-chloro-3-methylbutan-2-yl)prop-2-enamide.
Molecular Properties
| Compound Name | azane;N-(3-chloro-3-methylbutan-2-yl)prop-2-enamide |
| PubChem CID | 87146686 |
| Molecular Formula | C8H17ClN2O |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | azane;N-(3-chloro-3-methylbutan-2-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC(C)C(C)(C)Cl.N |
| InChI | InChI=1S/C8H14ClNO.H3N/c1-5-7(11)10-6(2)8(3,4)9;/h5-6H,1H2,2-4H3,(H,10,11);1H3 |
| InChIKey | QIWWSKHMACCERR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;N-(3-chloro-3-methylbutan-2-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N-(3-chloro-3-methylbutan-2-yl)prop-2-enamide?
The IUPAC name of azane;N-(3-chloro-3-methylbutan-2-yl)prop-2-enamide (CID 87146686) is azane;N-(3-chloro-3-methylbutan-2-yl)prop-2-enamide.
What is the SMILES notation for azane;N-(3-chloro-3-methylbutan-2-yl)prop-2-enamide?
The canonical SMILES for azane;N-(3-chloro-3-methylbutan-2-yl)prop-2-enamide is C=CC(=O)NC(C)C(C)(C)Cl.N.
What is the InChIKey of azane;N-(3-chloro-3-methylbutan-2-yl)prop-2-enamide?
The InChIKey is QIWWSKHMACCERR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClNO.H3N/c1-5-7(11)10-6(2)8(3,4)9;/h5-6H,1H2,2-4H3,(H,10,11);1H3.
What are the key properties of azane;N-(3-chloro-3-methylbutan-2-yl)prop-2-enamide?
azane;N-(3-chloro-3-methylbutan-2-yl)prop-2-enamide has a molecular weight of 192.69 g/mol, XLogP of 1.86, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N-(3-chloro-3-methylbutan-2-yl)prop-2-enamide is sourced from PubChem (CID 87146686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).