C14H27NO2 — CID 142409131
N-[3-(2,3-dimethylbutoxy)-3-methylbutan-2-yl]prop-2-enamide (PubChem CID 142409131) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is N-[3-(2,3-dimethylbutoxy)-3-methylbutan-2-yl]prop-2-enamide.
| Compound Name | N-[3-(2,3-dimethylbutoxy)-3-methylbutan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 142409131 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | N-[3-(2,3-dimethylbutoxy)-3-methylbutan-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC(C)C(C)(C)OCC(C)C(C)C |
| InChI | InChI=1S/C14H27NO2/c1-8-13(16)15-12(5)14(6,7)17-9-11(4)10(2)3/h8,10-12H,1,9H2,2-7H3,(H,15,16) |
| InChIKey | OUUVASRYWNBECL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|