C11H16N2O5S — CID 140562301
3,3-bis(prop-2-enoylamino)pent-4-ene-2-sulfonic acid (PubChem CID 140562301) has the molecular formula C11H16N2O5S and a molecular weight of 288.33 g/mol. Its IUPAC name is 3,3-bis(prop-2-enoylamino)pent-4-ene-2-sulfonic acid.
| Compound Name | 3,3-bis(prop-2-enoylamino)pent-4-ene-2-sulfonic acid |
|---|---|
| PubChem CID | 140562301 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3,3-bis(prop-2-enoylamino)pent-4-ene-2-sulfonic acid |
| SMILES | C=CC(=O)NC(C=C)(NC(=O)C=C)C(C)S(=O)(=O)O |
| InChI | InChI=1S/C11H16N2O5S/c1-5-9(14)12-11(7-3,13-10(15)6-2)8(4)19(16,17)18/h5-8H,1-3H2,4H3,(H,12,14)(H,13,15)(H,16,17,18) |
| InChIKey | TZILGKGVVUSKTK-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|