C12H21NO6S2 — CID 88714039
2-ethenylsulfonylpropan-2-yl 2-methyl-1-(prop-2-enoylamino)propane-1-sulfonate (PubChem CID 88714039) has the molecular formula C12H21NO6S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-ethenylsulfonylpropan-2-yl 2-methyl-1-(prop-2-enoylamino)propane-1-sulfonate.
| Compound Name | 2-ethenylsulfonylpropan-2-yl 2-methyl-1-(prop-2-enoylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 88714039 |
| Molecular Formula | C12H21NO6S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2-ethenylsulfonylpropan-2-yl 2-methyl-1-(prop-2-enoylamino)propane-1-sulfonate |
| SMILES | C=CC(=O)NC(C(C)C)S(=O)(=O)OC(C)(C)S(=O)(=O)C=C |
| InChI | InChI=1S/C12H21NO6S2/c1-7-10(14)13-11(9(3)4)21(17,18)19-12(5,6)20(15,16)8-2/h7-9,11H,1-2H2,3-6H3,(H,13,14) |
| InChIKey | JMIWJSJUEQUJNM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|