C8H15NO3P+ — CID 87336798
hydroxy-[2-methyl-1-(2-methylprop-2-enoylamino)propyl]-oxophosphanium (PubChem CID 87336798) has the molecular formula C8H15NO3P+ and a molecular weight of 204.19 g/mol. Its IUPAC name is hydroxy-[2-methyl-1-(2-methylprop-2-enoylamino)propyl]-oxophosphanium.
| Compound Name | hydroxy-[2-methyl-1-(2-methylprop-2-enoylamino)propyl]-oxophosphanium |
|---|---|
| PubChem CID | 87336798 |
| Molecular Formula | C8H15NO3P+ |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | hydroxy-[2-methyl-1-(2-methylprop-2-enoylamino)propyl]-oxophosphanium |
| SMILES | C=C(C)C(=O)NC(C(C)C)[P+](=O)O |
| InChI | InChI=1S/C8H14NO3P/c1-5(2)7(10)9-8(6(3)4)13(11)12/h6,8H,1H2,2-4H3,(H-,9,10,11,12)/p+1 |
| InChIKey | BSQOBKZNAVGJQO-UHFFFAOYSA-O |
| XLogP | 1.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|