C9H12F3NO — CID 176519546
N-[(2S)-1,1,1-trifluoropentan-2-yl]buta-2,3-dienamide (PubChem CID 176519546) has the molecular formula C9H12F3NO and a molecular weight of 207.19 g/mol. Its IUPAC name is N-[(2S)-1,1,1-trifluoropentan-2-yl]buta-2,3-dienamide.
| Compound Name | N-[(2S)-1,1,1-trifluoropentan-2-yl]buta-2,3-dienamide |
|---|---|
| PubChem CID | 176519546 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | N-[(2S)-1,1,1-trifluoropentan-2-yl]buta-2,3-dienamide |
| SMILES | C=C=CC(=O)N[C@@H](CCC)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO/c1-3-5-7(9(10,11)12)13-8(14)6-4-2/h6-7H,2-3,5H2,1H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | LVQHBVWMGCJDLE-ZETCQYMHSA-N |
| XLogP | 2.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|