C5H7NOS — CID 176523508
N-methylsulfanylbuta-2,3-dienamide (PubChem CID 176523508) has the molecular formula C5H7NOS and a molecular weight of 129.18 g/mol. Its IUPAC name is N-methylsulfanylbuta-2,3-dienamide.
| Compound Name | N-methylsulfanylbuta-2,3-dienamide |
|---|---|
| PubChem CID | 176523508 |
| Molecular Formula | C5H7NOS |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.02 |
| IUPAC Name | N-methylsulfanylbuta-2,3-dienamide |
| SMILES | C=C=CC(=O)NSC |
| InChI | InChI=1S/C5H7NOS/c1-3-4-5(7)6-8-2/h4H,1H2,2H3,(H,6,7) |
| InChIKey | HFSORMFLRZKZLF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|