About N-methylsulfanylbuta-2,3-dienamide
N-methylsulfanylbuta-2,3-dienamide (PubChem CID 176523508) has the molecular formula C5H7NOS
and a molecular weight of 129.18 g/mol. Its IUPAC name is N-methylsulfanylbuta-2,3-dienamide.
Molecular Properties
| Compound Name | N-methylsulfanylbuta-2,3-dienamide |
| PubChem CID | 176523508 |
| Molecular Formula | C5H7NOS |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.02 |
| IUPAC Name | N-methylsulfanylbuta-2,3-dienamide |
| SMILES | C=C=CC(=O)NSC |
| InChI | InChI=1S/C5H7NOS/c1-3-4-5(7)6-8-2/h4H,1H2,2H3,(H,6,7) |
| InChIKey | HFSORMFLRZKZLF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methylsulfanylbuta-2,3-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylsulfanylbuta-2,3-dienamide?
The IUPAC name of N-methylsulfanylbuta-2,3-dienamide (CID 176523508) is N-methylsulfanylbuta-2,3-dienamide.
What is the SMILES notation for N-methylsulfanylbuta-2,3-dienamide?
The canonical SMILES for N-methylsulfanylbuta-2,3-dienamide is C=C=CC(=O)NSC.
What is the InChIKey of N-methylsulfanylbuta-2,3-dienamide?
The InChIKey is HFSORMFLRZKZLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NOS/c1-3-4-5(7)6-8-2/h4H,1H2,2H3,(H,6,7).
What are the key properties of N-methylsulfanylbuta-2,3-dienamide?
N-methylsulfanylbuta-2,3-dienamide has a molecular weight of 129.18 g/mol, XLogP of 0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylsulfanylbuta-2,3-dienamide is sourced from PubChem (CID 176523508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).