C11H10O — CID 15525531
1-(4-methylphenyl)buta-2,3-dien-1-one (PubChem CID 15525531) has the molecular formula C11H10O and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-(4-methylphenyl)buta-2,3-dien-1-one.
| Compound Name | 1-(4-methylphenyl)buta-2,3-dien-1-one |
|---|---|
| PubChem CID | 15525531 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 1-(4-methylphenyl)buta-2,3-dien-1-one |
| SMILES | C=C=CC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H10O/c1-3-4-11(12)10-7-5-9(2)6-8-10/h4-8H,1H2,2H3 |
| InChIKey | GQGMOJJLHTVFHY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|