C11H12O2Si — CID 123785549
(4-methylphenyl)silyl buta-2,3-dienoate (PubChem CID 123785549) has the molecular formula C11H12O2Si and a molecular weight of 204.30 g/mol. Its IUPAC name is (4-methylphenyl)silyl buta-2,3-dienoate.
| Compound Name | (4-methylphenyl)silyl buta-2,3-dienoate |
|---|---|
| PubChem CID | 123785549 |
| Molecular Formula | C11H12O2Si |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | (4-methylphenyl)silyl buta-2,3-dienoate |
| SMILES | C=C=CC(=O)O[SiH2]c1ccc(C)cc1 |
| InChI | InChI=1S/C11H12O2Si/c1-3-4-11(12)13-14-10-7-5-9(2)6-8-10/h4-8H,1,14H2,2H3 |
| InChIKey | MMWLJNIDSVXHRV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|