C10H10O — CID 86151206
1-methyl-4-propa-1,2-dienoxybenzene (PubChem CID 86151206) has the molecular formula C10H10O and a molecular weight of 146.19 g/mol. Its IUPAC name is 1-methyl-4-propa-1,2-dienoxybenzene.
| Compound Name | 1-methyl-4-propa-1,2-dienoxybenzene |
|---|---|
| PubChem CID | 86151206 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 1-methyl-4-propa-1,2-dienoxybenzene |
| SMILES | C=C=COc1ccc(C)cc1 |
| InChI | InChI=1S/C10H10O/c1-3-8-11-10-6-4-9(2)5-7-10/h4-8H,1H2,2H3 |
| InChIKey | OWUZNMJAFZQOHJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|