About 1,4-bis(ethenoxy)benzene;ethane
1,4-bis(ethenoxy)benzene;ethane (PubChem CID 145326219) has the molecular formula C14H22O2
and a molecular weight of 222.33 g/mol. Its IUPAC name is 1,4-bis(ethenoxy)benzene;ethane.
Molecular Properties
| Compound Name | 1,4-bis(ethenoxy)benzene;ethane |
| PubChem CID | 145326219 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1,4-bis(ethenoxy)benzene;ethane |
| SMILES | C=COc1ccc(OC=C)cc1.CC.CC |
| InChI | InChI=1S/C10H10O2.2C2H6/c1-3-11-9-5-7-10(8-6-9)12-4-2;2*1-2/h3-8H,1-2H2;2*1-2H3 |
| InChIKey | PLVCLNSPGNHMQM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(ethenoxy)benzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(ethenoxy)benzene;ethane?
The IUPAC name of 1,4-bis(ethenoxy)benzene;ethane (CID 145326219) is 1,4-bis(ethenoxy)benzene;ethane.
What is the SMILES notation for 1,4-bis(ethenoxy)benzene;ethane?
The canonical SMILES for 1,4-bis(ethenoxy)benzene;ethane is C=COc1ccc(OC=C)cc1.CC.CC.
What is the InChIKey of 1,4-bis(ethenoxy)benzene;ethane?
The InChIKey is PLVCLNSPGNHMQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.2C2H6/c1-3-11-9-5-7-10(8-6-9)12-4-2;2*1-2/h3-8H,1-2H2;2*1-2H3.
What are the key properties of 1,4-bis(ethenoxy)benzene;ethane?
1,4-bis(ethenoxy)benzene;ethane has a molecular weight of 222.33 g/mol, XLogP of 4.78, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(ethenoxy)benzene;ethane is sourced from PubChem (CID 145326219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).