About 4-ethenoxybenzamide
4-ethenoxybenzamide (PubChem CID 66368618) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 4-ethenoxybenzamide.
Molecular Properties
| Compound Name | 4-ethenoxybenzamide |
| PubChem CID | 66368618 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 4-ethenoxybenzamide |
| SMILES | C=COc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C9H9NO2/c1-2-12-8-5-3-7(4-6-8)9(10)11/h2-6H,1H2,(H2,10,11) |
| InChIKey | MSGSBZGFFICEDA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenoxybenzamide?
The IUPAC name of 4-ethenoxybenzamide (CID 66368618) is 4-ethenoxybenzamide.
What is the SMILES notation for 4-ethenoxybenzamide?
The canonical SMILES for 4-ethenoxybenzamide is C=COc1ccc(C(N)=O)cc1.
What is the InChIKey of 4-ethenoxybenzamide?
The InChIKey is MSGSBZGFFICEDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c1-2-12-8-5-3-7(4-6-8)9(10)11/h2-6H,1H2,(H2,10,11).
What are the key properties of 4-ethenoxybenzamide?
4-ethenoxybenzamide has a molecular weight of 163.18 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenoxybenzamide is sourced from PubChem (CID 66368618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).