About (4-carbamoylphenyl) carbonochloridate
(4-carbamoylphenyl) carbonochloridate (PubChem CID 119084646) has the molecular formula C8H6ClNO3
and a molecular weight of 199.59 g/mol. Its IUPAC name is (4-carbamoylphenyl) carbonochloridate.
Molecular Properties
| Compound Name | (4-carbamoylphenyl) carbonochloridate |
| PubChem CID | 119084646 |
| Molecular Formula | C8H6ClNO3 |
| Molecular Weight | 199.59 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | (4-carbamoylphenyl) carbonochloridate |
| SMILES | NC(=O)c1ccc(OC(=O)Cl)cc1 |
| InChI | InChI=1S/C8H6ClNO3/c9-8(12)13-6-3-1-5(2-4-6)7(10)11/h1-4H,(H2,10,11) |
| InChIKey | RXWMVBDYABRJMK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.59 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze (4-carbamoylphenyl) carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-carbamoylphenyl) carbonochloridate?
The IUPAC name of (4-carbamoylphenyl) carbonochloridate (CID 119084646) is (4-carbamoylphenyl) carbonochloridate.
What is the SMILES notation for (4-carbamoylphenyl) carbonochloridate?
The canonical SMILES for (4-carbamoylphenyl) carbonochloridate is NC(=O)c1ccc(OC(=O)Cl)cc1.
What is the InChIKey of (4-carbamoylphenyl) carbonochloridate?
The InChIKey is RXWMVBDYABRJMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClNO3/c9-8(12)13-6-3-1-5(2-4-6)7(10)11/h1-4H,(H2,10,11).
What are the key properties of (4-carbamoylphenyl) carbonochloridate?
(4-carbamoylphenyl) carbonochloridate has a molecular weight of 199.59 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-carbamoylphenyl) carbonochloridate is sourced from PubChem (CID 119084646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).